C18H17N7 — CID 23535674
1-[4-(4-ethylanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine (PubChem CID 23535674) has the molecular formula C18H17N7 and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-[4-(4-ethylanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine.
| Compound Name | 1-[4-(4-ethylanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 23535674 |
| Molecular Formula | C18H17N7 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-[4-(4-ethylanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine |
| SMILES | CCc1ccc(Nc2ncnc(-n3c(N)nc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C18H17N7/c1-2-12-7-9-13(10-8-12)22-17-20-11-21-18(24-17)25-15-6-4-3-5-14(15)23-16(25)19/h3-11H,2H2,1H3,(H2,19,23)(H,20,21,22,24) |
| InChIKey | XIMXAVLOHPMWCF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |