C21H23BN6O3S — CID 140755635
[3-[[[6-ethyl-3-(2-methyl-4-sulfinamoylindol-1-yl)-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid (PubChem CID 140755635) has the molecular formula C21H23BN6O3S and a molecular weight of 450.33 g/mol. Its IUPAC name is [3-[[[6-ethyl-3-(2-methyl-4-sulfinamoylindol-1-yl)-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[6-ethyl-3-(2-methyl-4-sulfinamoylindol-1-yl)-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 140755635 |
| Molecular Formula | C21H23BN6O3S |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [3-[[[6-ethyl-3-(2-methyl-4-sulfinamoylindol-1-yl)-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid |
| SMILES | CCc1nnc(-n2c(C)cc3c(S(N)=O)cccc32)nc1NCc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C21H23BN6O3S/c1-3-17-20(24-12-14-6-4-7-15(11-14)22(29)30)25-21(27-26-17)28-13(2)10-16-18(28)8-5-9-19(16)32(23)31/h4-11,29-30H,3,12,23H2,1-2H3,(H,24,25,27) |
| InChIKey | AVXCBFIEUWIBSZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|