C20H20BN5O2 — CID 140755497
[1-[5-(benzylamino)-6-methyl-1,2,4-triazin-3-yl]-2-methylindol-4-yl]boronic acid (PubChem CID 140755497) has the molecular formula C20H20BN5O2 and a molecular weight of 373.23 g/mol. Its IUPAC name is [1-[5-(benzylamino)-6-methyl-1,2,4-triazin-3-yl]-2-methylindol-4-yl]boronic acid.
| Compound Name | [1-[5-(benzylamino)-6-methyl-1,2,4-triazin-3-yl]-2-methylindol-4-yl]boronic acid |
|---|---|
| PubChem CID | 140755497 |
| Molecular Formula | C20H20BN5O2 |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [1-[5-(benzylamino)-6-methyl-1,2,4-triazin-3-yl]-2-methylindol-4-yl]boronic acid |
| SMILES | Cc1nnc(-n2c(C)cc3c(B(O)O)cccc32)nc1NCc1ccccc1 |
| InChI | InChI=1S/C20H20BN5O2/c1-13-11-16-17(21(27)28)9-6-10-18(16)26(13)20-23-19(14(2)24-25-20)22-12-15-7-4-3-5-8-15/h3-11,27-28H,12H2,1-2H3,(H,22,23,25) |
| InChIKey | HGOHVXOBRYLDOW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|