C24H21N5O — CID 176965694
1-[4-(benzylamino)-6-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methylindole-4-carbaldehyde (PubChem CID 176965694) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is 1-[4-(benzylamino)-6-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methylindole-4-carbaldehyde.
| Compound Name | 1-[4-(benzylamino)-6-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methylindole-4-carbaldehyde |
|---|---|
| PubChem CID | 176965694 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-[4-(benzylamino)-6-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methylindole-4-carbaldehyde |
| SMILES | Cc1cc2c(NCc3ccccc3)nc(-n3c(C)cc4c(C=O)cccc43)nn2c1 |
| InChI | InChI=1S/C24H21N5O/c1-16-11-22-23(25-13-18-7-4-3-5-8-18)26-24(27-28(22)14-16)29-17(2)12-20-19(15-30)9-6-10-21(20)29/h3-12,14-15H,13H2,1-2H3,(H,25,26,27) |
| InChIKey | ZDDOYWNNUGAVOG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|