C24H23N5 — CID 118141313
1-[4-(benzylamino)-5-propan-2-ylpyrimidin-2-yl]-2-methylindole-4-carbonitrile (PubChem CID 118141313) has the molecular formula C24H23N5 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[4-(benzylamino)-5-propan-2-ylpyrimidin-2-yl]-2-methylindole-4-carbonitrile.
| Compound Name | 1-[4-(benzylamino)-5-propan-2-ylpyrimidin-2-yl]-2-methylindole-4-carbonitrile |
|---|---|
| PubChem CID | 118141313 |
| Molecular Formula | C24H23N5 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 1-[4-(benzylamino)-5-propan-2-ylpyrimidin-2-yl]-2-methylindole-4-carbonitrile |
| SMILES | Cc1cc2c(C#N)cccc2n1-c1ncc(C(C)C)c(NCc2ccccc2)n1 |
| InChI | InChI=1S/C24H23N5/c1-16(2)21-15-27-24(28-23(21)26-14-18-8-5-4-6-9-18)29-17(3)12-20-19(13-25)10-7-11-22(20)29/h4-12,15-16H,14H2,1-3H3,(H,26,27,28) |
| InChIKey | BIRHPIHVSDIMOL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |