C23H20N8 — CID 118141402
1-[5-(1-azidoethyl)-4-(benzylamino)pyrimidin-2-yl]-2-methylindole-4-carbonitrile (PubChem CID 118141402) has the molecular formula C23H20N8 and a molecular weight of 408.47 g/mol. Its IUPAC name is 1-[5-(1-azidoethyl)-4-(benzylamino)pyrimidin-2-yl]-2-methylindole-4-carbonitrile.
| Compound Name | 1-[5-(1-azidoethyl)-4-(benzylamino)pyrimidin-2-yl]-2-methylindole-4-carbonitrile |
|---|---|
| PubChem CID | 118141402 |
| Molecular Formula | C23H20N8 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[5-(1-azidoethyl)-4-(benzylamino)pyrimidin-2-yl]-2-methylindole-4-carbonitrile |
| SMILES | Cc1cc2c(C#N)cccc2n1-c1ncc(C(C)N=[N+]=[N-])c(NCc2ccccc2)n1 |
| InChI | InChI=1S/C23H20N8/c1-15-11-19-18(12-24)9-6-10-21(19)31(15)23-27-14-20(16(2)29-30-25)22(28-23)26-13-17-7-4-3-5-8-17/h3-11,14,16H,13H2,1-2H3,(H,26,27,28) |
| InChIKey | YRLLQMGUCKVCAZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|