C23H26BN5O3 — CID 140755610
[3-[[[6-ethyl-3-[4-(methoxymethyl)-2-methylindol-1-yl]-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid (PubChem CID 140755610) has the molecular formula C23H26BN5O3 and a molecular weight of 431.31 g/mol. Its IUPAC name is [3-[[[6-ethyl-3-[4-(methoxymethyl)-2-methylindol-1-yl]-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[6-ethyl-3-[4-(methoxymethyl)-2-methylindol-1-yl]-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 140755610 |
| Molecular Formula | C23H26BN5O3 |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | [3-[[[6-ethyl-3-[4-(methoxymethyl)-2-methylindol-1-yl]-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid |
| SMILES | CCc1nnc(-n2c(C)cc3c(COC)cccc32)nc1NCc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C23H26BN5O3/c1-4-20-22(25-13-16-7-5-9-18(12-16)24(30)31)26-23(28-27-20)29-15(2)11-19-17(14-32-3)8-6-10-21(19)29/h5-12,30-31H,4,13-14H2,1-3H3,(H,25,26,28) |
| InChIKey | PBKCVFHIJNPIIB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|