C20H20BFN6O3 — CID 140755607
[1-[6-ethyl-5-[(3-fluorophenyl)methylamino]-1,2,4-triazin-3-yl]-2-methoxybenzimidazol-4-yl]boronic acid (PubChem CID 140755607) has the molecular formula C20H20BFN6O3 and a molecular weight of 422.23 g/mol. Its IUPAC name is [1-[6-ethyl-5-[(3-fluorophenyl)methylamino]-1,2,4-triazin-3-yl]-2-methoxybenzimidazol-4-yl]boronic acid.
| Compound Name | [1-[6-ethyl-5-[(3-fluorophenyl)methylamino]-1,2,4-triazin-3-yl]-2-methoxybenzimidazol-4-yl]boronic acid |
|---|---|
| PubChem CID | 140755607 |
| Molecular Formula | C20H20BFN6O3 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [1-[6-ethyl-5-[(3-fluorophenyl)methylamino]-1,2,4-triazin-3-yl]-2-methoxybenzimidazol-4-yl]boronic acid |
| SMILES | CCc1nnc(-n2c(OC)nc3c(B(O)O)cccc32)nc1NCc1cccc(F)c1 |
| InChI | InChI=1S/C20H20BFN6O3/c1-3-15-18(23-11-12-6-4-7-13(22)10-12)25-19(27-26-15)28-16-9-5-8-14(21(29)30)17(16)24-20(28)31-2/h4-10,29-30H,3,11H2,1-2H3,(H,23,25,27) |
| InChIKey | HEVITVVXTJNHRA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|