C25H28BN5O3 — CID 145206213
[3-[[[2-(4-carbamoyl-2-methyl-2,3-dihydroindol-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 145206213) has the molecular formula C25H28BN5O3 and a molecular weight of 457.34 g/mol. Its IUPAC name is [3-[[[2-(4-carbamoyl-2-methyl-2,3-dihydroindol-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[2-(4-carbamoyl-2-methyl-2,3-dihydroindol-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145206213 |
| Molecular Formula | C25H28BN5O3 |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | [3-[[[2-(4-carbamoyl-2-methyl-2,3-dihydroindol-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | CC1Cc2c(C(N)=O)cccc2N1c1nc2c(c(NCc3cccc(B(O)O)c3)n1)CCCC2 |
| InChI | InChI=1S/C25H28BN5O3/c1-15-12-20-18(23(27)32)9-5-11-22(20)31(15)25-29-21-10-3-2-8-19(21)24(30-25)28-14-16-6-4-7-17(13-16)26(33)34/h4-7,9,11,13,15,33-34H,2-3,8,10,12,14H2,1H3,(H2,27,32)(H,28,29,30) |
| InChIKey | KYOXZUGYFGXGHF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|