C24H27BN6O3 — CID 145205993
[3-[[[2-(4-carbamoyl-2-methyl-2,3-dihydroindol-1-yl)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 145205993) has the molecular formula C24H27BN6O3 and a molecular weight of 458.33 g/mol. Its IUPAC name is [3-[[[2-(4-carbamoyl-2-methyl-2,3-dihydroindol-1-yl)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[2-(4-carbamoyl-2-methyl-2,3-dihydroindol-1-yl)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145205993 |
| Molecular Formula | C24H27BN6O3 |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | [3-[[[2-(4-carbamoyl-2-methyl-2,3-dihydroindol-1-yl)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | CC1Cc2c(C(N)=O)cccc2N1c1nc2c(c(NCc3cccc(B(O)O)c3)n1)NCCC2 |
| InChI | InChI=1S/C24H27BN6O3/c1-14-11-18-17(22(26)32)7-3-9-20(18)31(14)24-29-19-8-4-10-27-21(19)23(30-24)28-13-15-5-2-6-16(12-15)25(33)34/h2-3,5-7,9,12,14,27,33-34H,4,8,10-11,13H2,1H3,(H2,26,32)(H,28,29,30) |
| InChIKey | XRCZMRYVXSBTQC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|