C25H25N5O2 — CID 118141286
1-[4-(benzylamino)-5-(oxolan-2-yl)pyrimidin-2-yl]-2-methylindole-4-carboxamide (PubChem CID 118141286) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-[4-(benzylamino)-5-(oxolan-2-yl)pyrimidin-2-yl]-2-methylindole-4-carboxamide.
| Compound Name | 1-[4-(benzylamino)-5-(oxolan-2-yl)pyrimidin-2-yl]-2-methylindole-4-carboxamide |
|---|---|
| PubChem CID | 118141286 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-[4-(benzylamino)-5-(oxolan-2-yl)pyrimidin-2-yl]-2-methylindole-4-carboxamide |
| SMILES | Cc1cc2c(C(N)=O)cccc2n1-c1ncc(C2CCCO2)c(NCc2ccccc2)n1 |
| InChI | InChI=1S/C25H25N5O2/c1-16-13-19-18(23(26)31)9-5-10-21(19)30(16)25-28-15-20(22-11-6-12-32-22)24(29-25)27-14-17-7-3-2-4-8-17/h2-5,7-10,13,15,22H,6,11-12,14H2,1H3,(H2,26,31)(H,27,28,29) |
| InChIKey | CXJGAHSNUQGPJE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |