C15H19N5O3S — CID 66630757
N-[3-(4-amino-2-morpholin-4-ylpyrimidin-5-yl)phenyl]methanesulfonamide (PubChem CID 66630757) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is N-[3-(4-amino-2-morpholin-4-ylpyrimidin-5-yl)phenyl]methanesulfonamide.
| Compound Name | N-[3-(4-amino-2-morpholin-4-ylpyrimidin-5-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 66630757 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[3-(4-amino-2-morpholin-4-ylpyrimidin-5-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2cnc(N3CCOCC3)nc2N)c1 |
| InChI | InChI=1S/C15H19N5O3S/c1-24(21,22)19-12-4-2-3-11(9-12)13-10-17-15(18-14(13)16)20-5-7-23-8-6-20/h2-4,9-10,19H,5-8H2,1H3,(H2,16,17,18) |
| InChIKey | YZAKLNHEVCYQDA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |