C14H13Cl3N4O — CID 11508758
2-morpholin-4-yl-5-(2,3,5-trichlorophenyl)pyrimidin-4-amine (PubChem CID 11508758) has the molecular formula C14H13Cl3N4O and a molecular weight of 359.64 g/mol. Its IUPAC name is 2-morpholin-4-yl-5-(2,3,5-trichlorophenyl)pyrimidin-4-amine.
| Compound Name | 2-morpholin-4-yl-5-(2,3,5-trichlorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 11508758 |
| Molecular Formula | C14H13Cl3N4O |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 2-morpholin-4-yl-5-(2,3,5-trichlorophenyl)pyrimidin-4-amine |
| SMILES | Nc1nc(N2CCOCC2)ncc1-c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C14H13Cl3N4O/c15-8-5-9(12(17)11(16)6-8)10-7-19-14(20-13(10)18)21-1-3-22-4-2-21/h5-7H,1-4H2,(H2,18,19,20) |
| InChIKey | OQSAPRWJHNXIPB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|