C15H16Cl2N4O — CID 22360304
5-(3,5-dichlorophenyl)-6-methyl-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 22360304) has the molecular formula C15H16Cl2N4O and a molecular weight of 339.23 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-6-methyl-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | 5-(3,5-dichlorophenyl)-6-methyl-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 22360304 |
| Molecular Formula | C15H16Cl2N4O |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-6-methyl-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | Cc1nc(N2CCOCC2)nc(N)c1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N4O/c1-9-13(10-6-11(16)8-12(17)7-10)14(18)20-15(19-9)21-2-4-22-5-3-21/h6-8H,2-5H2,1H3,(H2,18,19,20) |
| InChIKey | XYAQXRWBALWEOU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |