C12H16N4OS — CID 14639124
5,6-dimethyl-2-morpholin-4-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 14639124) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 5,6-dimethyl-2-morpholin-4-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-2-morpholin-4-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 14639124 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 5,6-dimethyl-2-morpholin-4-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(N3CCOCC3)nc(N)c2c1C |
| InChI | InChI=1S/C12H16N4OS/c1-7-8(2)18-11-9(7)10(13)14-12(15-11)16-3-5-17-6-4-16/h3-6H2,1-2H3,(H2,13,14,15) |
| InChIKey | DSRCQVBSOABTRF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |