C12H15N3OS2 — CID 15047609
5,6-dimethyl-2-morpholin-4-ylthieno[2,3-d][1,3]thiazin-4-imine (PubChem CID 15047609) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is 5,6-dimethyl-2-morpholin-4-ylthieno[2,3-d][1,3]thiazin-4-imine.
| Compound Name | 5,6-dimethyl-2-morpholin-4-ylthieno[2,3-d][1,3]thiazin-4-imine |
|---|---|
| PubChem CID | 15047609 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 5,6-dimethyl-2-morpholin-4-ylthieno[2,3-d][1,3]thiazin-4-imine |
| SMILES | [H]/N=c1\sc(N2CCOCC2)nc2sc(C)c(C)c12 |
| InChI | InChI=1S/C12H15N3OS2/c1-7-8(2)17-11-9(7)10(13)18-12(14-11)15-3-5-16-6-4-15/h13H,3-6H2,1-2H3/b13-10- |
| InChIKey | QGPAZEOZRFYDQV-RAXLEYEMSA-N |
| XLogP | 2.29 |
| TPSA | 49.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |