C13H16N6O — CID 115375453
4-(5-methyl-3-pyridinyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 115375453) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-(5-methyl-3-pyridinyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(5-methyl-3-pyridinyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115375453 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-(5-methyl-3-pyridinyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Cc1cncc(-c2nc(N)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C13H16N6O/c1-9-6-10(8-15-7-9)11-16-12(14)18-13(17-11)19-2-4-20-5-3-19/h6-8H,2-5H2,1H3,(H2,14,16,17,18) |
| InChIKey | KMDWHSVAVQHVPH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |