C13H14BrN5O — CID 115503777
4-(2-bromophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 115503777) has the molecular formula C13H14BrN5O and a molecular weight of 336.19 g/mol. Its IUPAC name is 4-(2-bromophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-bromophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115503777 |
| Molecular Formula | C13H14BrN5O |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-(2-bromophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-c2ccccc2Br)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H14BrN5O/c14-10-4-2-1-3-9(10)11-16-12(15)18-13(17-11)19-5-7-20-8-6-19/h1-4H,5-8H2,(H2,15,16,17,18) |
| InChIKey | SZWRPQDBQAEGAS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |