C11H11BrN4 — CID 63868723
4-(2-bromophenyl)-6-ethyl-1,3,5-triazin-2-amine (PubChem CID 63868723) has the molecular formula C11H11BrN4 and a molecular weight of 279.14 g/mol. Its IUPAC name is 4-(2-bromophenyl)-6-ethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-bromophenyl)-6-ethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63868723 |
| Molecular Formula | C11H11BrN4 |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 4-(2-bromophenyl)-6-ethyl-1,3,5-triazin-2-amine |
| SMILES | CCc1nc(N)nc(-c2ccccc2Br)n1 |
| InChI | InChI=1S/C11H11BrN4/c1-2-9-14-10(16-11(13)15-9)7-5-3-4-6-8(7)12/h3-6H,2H2,1H3,(H2,13,14,15,16) |
| InChIKey | ITOXBYAWNWZAII-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |