C18H23N3O3S — CID 171675302
N-[3-[(4-morpholin-4-ylanilino)methyl]phenyl]methanesulfonamide (PubChem CID 171675302) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-[3-[(4-morpholin-4-ylanilino)methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(4-morpholin-4-ylanilino)methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 171675302 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[3-[(4-morpholin-4-ylanilino)methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(CNc2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C18H23N3O3S/c1-25(22,23)20-17-4-2-3-15(13-17)14-19-16-5-7-18(8-6-16)21-9-11-24-12-10-21/h2-8,13,19-20H,9-12,14H2,1H3 |
| InChIKey | BEQOOGMYRNOSOS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|