C12H19IN4O2S — CID 120969422
N-[3-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]phenyl]methanesulfonamide;hydroiodide (PubChem CID 120969422) has the molecular formula C12H19IN4O2S and a molecular weight of 410.28 g/mol. Its IUPAC name is N-[3-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]phenyl]methanesulfonamide;hydroiodide.
| Compound Name | N-[3-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]phenyl]methanesulfonamide;hydroiodide |
|---|---|
| PubChem CID | 120969422 |
| Molecular Formula | C12H19IN4O2S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | N-[3-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]phenyl]methanesulfonamide;hydroiodide |
| SMILES | CN1CCN=C1NCc1cccc(NS(C)(=O)=O)c1.I |
| InChI | InChI=1S/C12H18N4O2S.HI/c1-16-7-6-13-12(16)14-9-10-4-3-5-11(8-10)15-19(2,17)18;/h3-5,8,15H,6-7,9H2,1-2H3,(H,13,14);1H |
| InChIKey | FVWSGFFXTJKPFJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|