C13H20IN3O2S — CID 120970164
1-methyl-N-[[4-(methylsulfonylmethyl)phenyl]methyl]-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120970164) has the molecular formula C13H20IN3O2S and a molecular weight of 409.29 g/mol. Its IUPAC name is 1-methyl-N-[[4-(methylsulfonylmethyl)phenyl]methyl]-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | 1-methyl-N-[[4-(methylsulfonylmethyl)phenyl]methyl]-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120970164 |
| Molecular Formula | C13H20IN3O2S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 1-methyl-N-[[4-(methylsulfonylmethyl)phenyl]methyl]-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CN1CCN=C1NCc1ccc(CS(C)(=O)=O)cc1.I |
| InChI | InChI=1S/C13H19N3O2S.HI/c1-16-8-7-14-13(16)15-9-11-3-5-12(6-4-11)10-19(2,17)18;/h3-6H,7-10H2,1-2H3,(H,14,15);1H |
| InChIKey | MDUQTPUIHGFODT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|