C18H22IN3O — CID 120969601
1-methyl-N-[(4-phenylmethoxyphenyl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120969601) has the molecular formula C18H22IN3O and a molecular weight of 423.30 g/mol. Its IUPAC name is 1-methyl-N-[(4-phenylmethoxyphenyl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | 1-methyl-N-[(4-phenylmethoxyphenyl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120969601 |
| Molecular Formula | C18H22IN3O |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 1-methyl-N-[(4-phenylmethoxyphenyl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CN1CCN=C1NCc1ccc(OCc2ccccc2)cc1.I |
| InChI | InChI=1S/C18H21N3O.HI/c1-21-12-11-19-18(21)20-13-15-7-9-17(10-8-15)22-14-16-5-3-2-4-6-16;/h2-10H,11-14H2,1H3,(H,19,20);1H |
| InChIKey | PUOMKYYINVRZRB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|