C18H21FIN3O — CID 120969603
N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120969603) has the molecular formula C18H21FIN3O and a molecular weight of 441.29 g/mol. Its IUPAC name is N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120969603 |
| Molecular Formula | C18H21FIN3O |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CN1CCN=C1NCc1ccc(OCc2cccc(F)c2)cc1.I |
| InChI | InChI=1S/C18H20FN3O.HI/c1-22-10-9-20-18(22)21-12-14-5-7-17(8-6-14)23-13-15-3-2-4-16(19)11-15;/h2-8,11H,9-10,12-13H2,1H3,(H,20,21);1H |
| InChIKey | LEBUIPCSYBNGPL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|