C23H26ClN5O6 — CID 167164414
N-[5-[[4-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-chloropyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]prop-2-enamide (PubChem CID 167164414) has the molecular formula C23H26ClN5O6 and a molecular weight of 503.94 g/mol. Its IUPAC name is N-[5-[[4-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-chloropyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]prop-2-enamide.
| Compound Name | N-[5-[[4-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-chloropyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167164414 |
| Molecular Formula | C23H26ClN5O6 |
| Molecular Weight | 503.94 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | N-[5-[[4-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-chloropyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(O[C@@H]3CO[C@H]4[C@@H]3OC[C@H]4O)n2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C23H26ClN5O6/c1-2-19(31)27-15-9-13(3-4-16(15)29-5-7-32-8-6-29)26-23-25-10-14(24)22(28-23)35-18-12-34-20-17(30)11-33-21(18)20/h2-4,9-10,17-18,20-21,30H,1,5-8,11-12H2,(H,27,31)(H,25,26,28)/t17-,18-,20-,21-/m1/s1 |
| InChIKey | IGFXLLZDACGNOA-VURPSTOHSA-N |
| XLogP | 1.74 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.94 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|