C30H38ClN7O4S — CID 161177392
N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-[4-(2-methoxyethyl)piperazin-1-yl]-4-methylphenyl]prop-2-enamide (PubChem CID 161177392) has the molecular formula C30H38ClN7O4S and a molecular weight of 628.20 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-[4-(2-methoxyethyl)piperazin-1-yl]-4-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-[4-(2-methoxyethyl)piperazin-1-yl]-4-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 161177392 |
| Molecular Formula | C30H38ClN7O4S |
| Molecular Weight | 628.20 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-[4-(2-methoxyethyl)piperazin-1-yl]-4-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)c(C)cc1N1CCN(CCOC)CC1 |
| InChI | InChI=1S/C30H38ClN7O4S/c1-6-28(39)33-25-18-24(21(4)17-26(25)38-13-11-37(12-14-38)15-16-42-5)35-30-32-19-22(31)29(36-30)34-23-9-7-8-10-27(23)43(40,41)20(2)3/h6-10,17-20H,1,11-16H2,2-5H3,(H,33,39)(H2,32,34,35,36) |
| InChIKey | PZEAGVHGAALFSF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.20 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|