C27H34ClN9O3S — CID 163276225
2-N-[4-[4-[2-(2-azidoethoxy)ethyl]piperazin-1-yl]phenyl]-5-chloro-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine (PubChem CID 163276225) has the molecular formula C27H34ClN9O3S and a molecular weight of 600.15 g/mol. Its IUPAC name is 2-N-[4-[4-[2-(2-azidoethoxy)ethyl]piperazin-1-yl]phenyl]-5-chloro-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-[4-[2-(2-azidoethoxy)ethyl]piperazin-1-yl]phenyl]-5-chloro-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163276225 |
| Molecular Formula | C27H34ClN9O3S |
| Molecular Weight | 600.15 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | 2-N-[4-[4-[2-(2-azidoethoxy)ethyl]piperazin-1-yl]phenyl]-5-chloro-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(N3CCN(CCOCCN=[N+]=[N-])CC3)cc2)ncc1Cl |
| InChI | InChI=1S/C27H34ClN9O3S/c1-20(2)41(38,39)25-6-4-3-5-24(25)33-26-23(28)19-30-27(34-26)32-21-7-9-22(10-8-21)37-14-12-36(13-15-37)16-18-40-17-11-31-35-29/h3-10,19-20H,11-18H2,1-2H3,(H2,30,32,33,34) |
| InChIKey | CNFLAROBBLVHAX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.15 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|