C20H19ClN6O4S — CID 134138765
5-chloro-2-N-[(E)-(4-nitrophenyl)methylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine (PubChem CID 134138765) has the molecular formula C20H19ClN6O4S and a molecular weight of 474.93 g/mol. Its IUPAC name is 5-chloro-2-N-[(E)-(4-nitrophenyl)methylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[(E)-(4-nitrophenyl)methylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134138765 |
| Molecular Formula | C20H19ClN6O4S |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 5-chloro-2-N-[(E)-(4-nitrophenyl)methylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(N/N=C/c2ccc([N+](=O)[O-])cc2)ncc1Cl |
| InChI | InChI=1S/C20H19ClN6O4S/c1-13(2)32(30,31)18-6-4-3-5-17(18)24-19-16(21)12-22-20(25-19)26-23-11-14-7-9-15(10-8-14)27(28)29/h3-13H,1-2H3,(H2,22,24,25,26)/b23-11+ |
| InChIKey | RSIZEYOOMNTXFM-FOKLQQMPSA-N |
| XLogP | 4.41 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|