C20H20ClN5O4S — CID 67465463
5-chloro-2-N-[(3-nitrophenyl)methyl]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine (PubChem CID 67465463) has the molecular formula C20H20ClN5O4S and a molecular weight of 461.93 g/mol. Its IUPAC name is 5-chloro-2-N-[(3-nitrophenyl)methyl]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[(3-nitrophenyl)methyl]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67465463 |
| Molecular Formula | C20H20ClN5O4S |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 5-chloro-2-N-[(3-nitrophenyl)methyl]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(NCc2cccc([N+](=O)[O-])c2)ncc1Cl |
| InChI | InChI=1S/C20H20ClN5O4S/c1-13(2)31(29,30)18-9-4-3-8-17(18)24-19-16(21)12-23-20(25-19)22-11-14-6-5-7-15(10-14)26(27)28/h3-10,12-13H,11H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | TWVDLHGNFBVKMF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|