C38H40O10 — CID 154624770
1-O-[4-[9,9-dimethyl-7-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyfluoren-2-yl]oxybutyl] 4-O-methyl 2-methylidenebutanedioate (PubChem CID 154624770) has the molecular formula C38H40O10 and a molecular weight of 656.73 g/mol. Its IUPAC name is 1-O-[4-[9,9-dimethyl-7-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyfluoren-2-yl]oxybutyl] 4-O-methyl 2-methylidenebutanedioate.
| Compound Name | 1-O-[4-[9,9-dimethyl-7-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyfluoren-2-yl]oxybutyl] 4-O-methyl 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624770 |
| Molecular Formula | C38H40O10 |
| Molecular Weight | 656.73 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | 1-O-[4-[9,9-dimethyl-7-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyfluoren-2-yl]oxybutyl] 4-O-methyl 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCOc1ccc(C(=O)Oc2ccc3c(c2)C(C)(C)c2cc(OCCCCOC(=O)C(=C)CC(=O)OC)ccc2-3)cc1 |
| InChI | InChI=1S/C38H40O10/c1-6-34(39)46-21-9-20-44-27-12-10-26(11-13-27)37(42)48-29-15-17-31-30-16-14-28(23-32(30)38(3,4)33(31)24-29)45-18-7-8-19-47-36(41)25(2)22-35(40)43-5/h6,10-17,23-24H,1-2,7-9,18-22H2,3-5H3 |
| InChIKey | TUUBASSDYLZXNY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.73 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|