C40H46O10 — CID 154624885
1-O-[6-[4-[3-ethyl-4-[4-(4-prop-2-enoyloxybutoxy)phenoxy]carbonylphenyl]phenoxy]hexyl] 4-O-methyl 2-methylidenebutanedioate (PubChem CID 154624885) has the molecular formula C40H46O10 and a molecular weight of 686.80 g/mol. Its IUPAC name is 1-O-[6-[4-[3-ethyl-4-[4-(4-prop-2-enoyloxybutoxy)phenoxy]carbonylphenyl]phenoxy]hexyl] 4-O-methyl 2-methylidenebutanedioate.
| Compound Name | 1-O-[6-[4-[3-ethyl-4-[4-(4-prop-2-enoyloxybutoxy)phenoxy]carbonylphenyl]phenoxy]hexyl] 4-O-methyl 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624885 |
| Molecular Formula | C40H46O10 |
| Molecular Weight | 686.80 g/mol |
| Exact Mass | 686.31 |
| IUPAC Name | 1-O-[6-[4-[3-ethyl-4-[4-(4-prop-2-enoyloxybutoxy)phenoxy]carbonylphenyl]phenoxy]hexyl] 4-O-methyl 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCCOc1ccc(OC(=O)c2ccc(-c3ccc(OCCCCCCOC(=O)C(=C)CC(=O)OC)cc3)cc2CC)cc1 |
| InChI | InChI=1S/C40H46O10/c1-5-30-28-32(15-22-36(30)40(44)50-35-20-18-34(19-21-35)47-24-11-12-25-48-37(41)6-2)31-13-16-33(17-14-31)46-23-9-7-8-10-26-49-39(43)29(3)27-38(42)45-4/h6,13-22,28H,2-3,5,7-12,23-27H2,1,4H3 |
| InChIKey | KZMYDFGAKUPETC-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.80 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|