C34H32O8 — CID 154624850
4-O-methyl 1-O-[4-[(E)-3-[4-[4-(4-prop-2-enoyloxybutoxy)phenyl]phenyl]prop-2-enoyl]phenyl] 2-methylidenebutanedioate (PubChem CID 154624850) has the molecular formula C34H32O8 and a molecular weight of 568.62 g/mol. Its IUPAC name is 4-O-methyl 1-O-[4-[(E)-3-[4-[4-(4-prop-2-enoyloxybutoxy)phenyl]phenyl]prop-2-enoyl]phenyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-methyl 1-O-[4-[(E)-3-[4-[4-(4-prop-2-enoyloxybutoxy)phenyl]phenyl]prop-2-enoyl]phenyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624850 |
| Molecular Formula | C34H32O8 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 4-O-methyl 1-O-[4-[(E)-3-[4-[4-(4-prop-2-enoyloxybutoxy)phenyl]phenyl]prop-2-enoyl]phenyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCCOc1ccc(-c2ccc(/C=C/C(=O)c3ccc(OC(=O)C(=C)CC(=O)OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H32O8/c1-4-32(36)41-22-6-5-21-40-29-16-12-27(13-17-29)26-10-7-25(8-11-26)9-20-31(35)28-14-18-30(19-15-28)42-34(38)24(2)23-33(37)39-3/h4,7-20H,1-2,5-6,21-23H2,3H3/b20-9+ |
| InChIKey | JRISUQMSMXCLNP-AWQFTUOYSA-N |
| XLogP | 6.16 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|