C31H34O9 — CID 154625004
4-O-methyl 1-O-[4-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]butyl] 2-methylidenebutanedioate (PubChem CID 154625004) has the molecular formula C31H34O9 and a molecular weight of 550.60 g/mol. Its IUPAC name is 4-O-methyl 1-O-[4-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]butyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-methyl 1-O-[4-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]butyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154625004 |
| Molecular Formula | C31H34O9 |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 4-O-methyl 1-O-[4-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]butyl] 2-methylidenebutanedioate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(=O)/C=C/c2ccc(OCCCCOC(=O)C(=C)CC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C31H34O9/c1-22(2)30(34)40-20-19-38-27-14-10-25(11-15-27)28(32)16-9-24-7-12-26(13-8-24)37-17-5-6-18-39-31(35)23(3)21-29(33)36-4/h7-16H,1,3,5-6,17-21H2,2,4H3/b16-9+ |
| InChIKey | DNANTYHBMIJRDZ-CXUHLZMHSA-N |
| XLogP | 4.90 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|