C38H46O9 — CID 154624735
4-O-cyclohexyl 1-O-[6-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]prop-2-enoyl]phenoxy]hexyl] 2-methylidenebutanedioate (PubChem CID 154624735) has the molecular formula C38H46O9 and a molecular weight of 646.78 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[6-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]prop-2-enoyl]phenoxy]hexyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[6-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]prop-2-enoyl]phenoxy]hexyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624735 |
| Molecular Formula | C38H46O9 |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[6-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]prop-2-enoyl]phenoxy]hexyl] 2-methylidenebutanedioate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(/C=C/C(=O)c2ccc(OCCCCCCOC(=O)C(=C)CC(=O)OC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C38H46O9/c1-28(2)37(41)46-26-25-44-32-18-13-30(14-19-32)15-22-35(39)31-16-20-33(21-17-31)43-23-9-4-5-10-24-45-38(42)29(3)27-36(40)47-34-11-7-6-8-12-34/h13-22,34H,1,3-12,23-27H2,2H3/b22-15+ |
| InChIKey | IKQCAPOEVRUJMN-PXLXIMEGSA-N |
| XLogP | 7.39 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|