C32H33O8Y- — CID 167370288
[2-(2-methylprop-2-enoyloxymethyl)-4-[4-[3-[4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoyl]phenoxy]butyl] 2-methylprop-2-enoate;yttrium (PubChem CID 167370288) has the molecular formula C32H33O8Y- and a molecular weight of 634.51 g/mol. Its IUPAC name is [2-(2-methylprop-2-enoyloxymethyl)-4-[4-[3-[4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoyl]phenoxy]butyl] 2-methylprop-2-enoate;yttrium.
| Compound Name | [2-(2-methylprop-2-enoyloxymethyl)-4-[4-[3-[4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoyl]phenoxy]butyl] 2-methylprop-2-enoate;yttrium |
|---|---|
| PubChem CID | 167370288 |
| Molecular Formula | C32H33O8Y- |
| Molecular Weight | 634.51 g/mol |
| Exact Mass | 634.12 |
| IUPAC Name | [2-(2-methylprop-2-enoyloxymethyl)-4-[4-[3-[4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoyl]phenoxy]butyl] 2-methylprop-2-enoate;yttrium |
| SMILES | C=C(C)C(=O)OC[C-](CCOc1ccc(C(=O)C=Cc2ccc(OC(=O)C(=C)C)cc2)cc1)COC(=O)C(=C)C.[Y] |
| InChI | InChI=1S/C32H33O8.Y/c1-21(2)30(34)38-19-25(20-39-31(35)22(3)4)17-18-37-27-14-10-26(11-15-27)29(33)16-9-24-7-12-28(13-8-24)40-32(36)23(5)6;/h7-16H,1,3,5,17-20H2,2,4,6H3;/q-1; |
| InChIKey | GGRUBAMFLCAISB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|