C39H35NO6 — CID 101177227
6-[4-(4-cyanophenyl)phenoxy]hexyl 4-[(E)-3-[4-(2-methylprop-2-enoyloxy)phenyl]-3-oxoprop-1-enyl]benzoate (PubChem CID 101177227) has the molecular formula C39H35NO6 and a molecular weight of 613.71 g/mol. Its IUPAC name is 6-[4-(4-cyanophenyl)phenoxy]hexyl 4-[(E)-3-[4-(2-methylprop-2-enoyloxy)phenyl]-3-oxoprop-1-enyl]benzoate.
| Compound Name | 6-[4-(4-cyanophenyl)phenoxy]hexyl 4-[(E)-3-[4-(2-methylprop-2-enoyloxy)phenyl]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 101177227 |
| Molecular Formula | C39H35NO6 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 6-[4-(4-cyanophenyl)phenoxy]hexyl 4-[(E)-3-[4-(2-methylprop-2-enoyloxy)phenyl]-3-oxoprop-1-enyl]benzoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(=O)/C=C/c2ccc(C(=O)OCCCCCCOc3ccc(-c4ccc(C#N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H35NO6/c1-28(2)38(42)46-36-22-18-33(19-23-36)37(41)24-11-29-7-14-34(15-8-29)39(43)45-26-6-4-3-5-25-44-35-20-16-32(17-21-35)31-12-9-30(27-40)10-13-31/h7-24H,1,3-6,25-26H2,2H3/b24-11+ |
| InChIKey | IQVFNVZIVUQQOJ-BHGWPJFGSA-N |
| XLogP | 8.40 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|