C27H29NO4 — CID 157298758
6-[4-[(E)-4-(4-cyanophenyl)-3-oxobut-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 157298758) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is 6-[4-[(E)-4-(4-cyanophenyl)-3-oxobut-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-[(E)-4-(4-cyanophenyl)-3-oxobut-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 157298758 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 6-[4-[(E)-4-(4-cyanophenyl)-3-oxobut-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(/C=C/C(=O)Cc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C27H29NO4/c1-21(2)27(30)32-18-6-4-3-5-17-31-26-15-12-22(13-16-26)11-14-25(29)19-23-7-9-24(20-28)10-8-23/h7-16H,1,3-6,17-19H2,2H3/b14-11+ |
| InChIKey | UXTNWGXZXWYTDR-SDNWHVSQSA-N |
| XLogP | 5.44 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|