C37H38O11 — CID 148970419
4-[4-[(E)-3-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]prop-2-enoyl]oxyphenoxy]butyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 148970419) has the molecular formula C37H38O11 and a molecular weight of 658.70 g/mol. Its IUPAC name is 4-[4-[(E)-3-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]prop-2-enoyl]oxyphenoxy]butyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 4-[4-[(E)-3-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]prop-2-enoyl]oxyphenoxy]butyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 148970419 |
| Molecular Formula | C37H38O11 |
| Molecular Weight | 658.70 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | 4-[4-[(E)-3-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]prop-2-enoyl]oxyphenoxy]butyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(-c2ccc(/C=C/C(=O)Oc3ccc(OCCCCOC(=O)C(=C)CO)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H38O11/c1-3-34(39)44-23-5-7-25-46-37(42)48-33-15-13-30(14-16-33)29-11-8-28(9-12-29)10-21-35(40)47-32-19-17-31(18-20-32)43-22-4-6-24-45-36(41)27(2)26-38/h3,8-21,38H,1-2,4-7,22-26H2/b21-10+ |
| InChIKey | PTTGLBQUQVMNGO-UFFVCSGVSA-N |
| XLogP | 6.25 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.70 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|