C15H16F2N2O — CID 122561917
5-(2,3-difluoro-4-pentylphenyl)-1H-pyrimidin-2-one (PubChem CID 122561917) has the molecular formula C15H16F2N2O and a molecular weight of 278.30 g/mol. Its IUPAC name is 5-(2,3-difluoro-4-pentylphenyl)-1H-pyrimidin-2-one.
| Compound Name | 5-(2,3-difluoro-4-pentylphenyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 122561917 |
| Molecular Formula | C15H16F2N2O |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5-(2,3-difluoro-4-pentylphenyl)-1H-pyrimidin-2-one |
| SMILES | CCCCCc1ccc(-c2cnc(=O)[nH]c2)c(F)c1F |
| InChI | InChI=1S/C15H16F2N2O/c1-2-3-4-5-10-6-7-12(14(17)13(10)16)11-8-18-15(20)19-9-11/h6-9H,2-5H2,1H3,(H,18,19,20) |
| InChIKey | PQFZZLZTMQWADI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|