C26H23F4N — CID 58141040
5-(4-butyl-2,3-difluorophenyl)-2-[2-(2,3-difluoro-4-propylphenyl)ethynyl]pyridine (PubChem CID 58141040) has the molecular formula C26H23F4N and a molecular weight of 425.47 g/mol. Its IUPAC name is 5-(4-butyl-2,3-difluorophenyl)-2-[2-(2,3-difluoro-4-propylphenyl)ethynyl]pyridine.
| Compound Name | 5-(4-butyl-2,3-difluorophenyl)-2-[2-(2,3-difluoro-4-propylphenyl)ethynyl]pyridine |
|---|---|
| PubChem CID | 58141040 |
| Molecular Formula | C26H23F4N |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 5-(4-butyl-2,3-difluorophenyl)-2-[2-(2,3-difluoro-4-propylphenyl)ethynyl]pyridine |
| SMILES | CCCCc1ccc(-c2ccc(C#Cc3ccc(CCC)c(F)c3F)nc2)c(F)c1F |
| InChI | InChI=1S/C26H23F4N/c1-3-5-7-18-12-15-22(26(30)25(18)29)20-11-14-21(31-16-20)13-10-19-9-8-17(6-4-2)23(27)24(19)28/h8-9,11-12,14-16H,3-7H2,1-2H3 |
| InChIKey | QASVOWJZKTVROU-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|