C22H26F2N2O — CID 139715582
2-(4-decoxy-2,3-difluorophenyl)-5-ethynylpyrimidine (PubChem CID 139715582) has the molecular formula C22H26F2N2O and a molecular weight of 372.46 g/mol. Its IUPAC name is 2-(4-decoxy-2,3-difluorophenyl)-5-ethynylpyrimidine.
| Compound Name | 2-(4-decoxy-2,3-difluorophenyl)-5-ethynylpyrimidine |
|---|---|
| PubChem CID | 139715582 |
| Molecular Formula | C22H26F2N2O |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-(4-decoxy-2,3-difluorophenyl)-5-ethynylpyrimidine |
| SMILES | C#Cc1cnc(-c2ccc(OCCCCCCCCCC)c(F)c2F)nc1 |
| InChI | InChI=1S/C22H26F2N2O/c1-3-5-6-7-8-9-10-11-14-27-19-13-12-18(20(23)21(19)24)22-25-15-17(4-2)16-26-22/h2,12-13,15-16H,3,5-11,14H2,1H3 |
| InChIKey | BMGAXUMLHFCDML-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|