C29H38F2O3 — CID 19430949
[2-fluoro-4-(3-fluoro-4-octoxyphenyl)phenyl] 3-butylcyclobutane-1-carboxylate (PubChem CID 19430949) has the molecular formula C29H38F2O3 and a molecular weight of 472.62 g/mol. Its IUPAC name is [2-fluoro-4-(3-fluoro-4-octoxyphenyl)phenyl] 3-butylcyclobutane-1-carboxylate.
| Compound Name | [2-fluoro-4-(3-fluoro-4-octoxyphenyl)phenyl] 3-butylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 19430949 |
| Molecular Formula | C29H38F2O3 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | [2-fluoro-4-(3-fluoro-4-octoxyphenyl)phenyl] 3-butylcyclobutane-1-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)C3CC(CCCC)C3)c(F)c2)cc1F |
| InChI | InChI=1S/C29H38F2O3/c1-3-5-7-8-9-10-16-33-27-14-12-22(19-25(27)30)23-13-15-28(26(31)20-23)34-29(32)24-17-21(18-24)11-6-4-2/h12-15,19-21,24H,3-11,16-18H2,1-2H3 |
| InChIKey | NHPZTEGBYQOBGY-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|