C35H51FO3 — CID 58240516
[4-[4-(3,7-dimethyloctoxy)-3-fluorophenyl]-2-methylphenyl] 4-pentylcyclohexane-1-carboxylate (PubChem CID 58240516) has the molecular formula C35H51FO3 and a molecular weight of 538.79 g/mol. Its IUPAC name is [4-[4-(3,7-dimethyloctoxy)-3-fluorophenyl]-2-methylphenyl] 4-pentylcyclohexane-1-carboxylate.
| Compound Name | [4-[4-(3,7-dimethyloctoxy)-3-fluorophenyl]-2-methylphenyl] 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58240516 |
| Molecular Formula | C35H51FO3 |
| Molecular Weight | 538.79 g/mol |
| Exact Mass | 538.38 |
| IUPAC Name | [4-[4-(3,7-dimethyloctoxy)-3-fluorophenyl]-2-methylphenyl] 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)Oc2ccc(-c3ccc(OCCC(C)CCCC(C)C)c(F)c3)cc2C)CC1 |
| InChI | InChI=1S/C35H51FO3/c1-6-7-8-12-28-13-15-29(16-14-28)35(37)39-33-19-17-30(23-27(33)5)31-18-20-34(32(36)24-31)38-22-21-26(4)11-9-10-25(2)3/h17-20,23-26,28-29H,6-16,21-22H2,1-5H3 |
| InChIKey | PCADIGOYHVGXKF-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.79 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|