C27H34F2O — CID 139863075
3-ethoxy-1,2-difluoro-7-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]naphthalene (PubChem CID 139863075) has the molecular formula C27H34F2O and a molecular weight of 412.56 g/mol. Its IUPAC name is 3-ethoxy-1,2-difluoro-7-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]naphthalene.
| Compound Name | 3-ethoxy-1,2-difluoro-7-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]naphthalene |
|---|---|
| PubChem CID | 139863075 |
| Molecular Formula | C27H34F2O |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 3-ethoxy-1,2-difluoro-7-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]naphthalene |
| SMILES | C/C=C/C1CCC(C2CCC(c3ccc4cc(OCC)c(F)c(F)c4c3)CC2)CC1 |
| InChI | InChI=1S/C27H34F2O/c1-3-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)22-14-15-23-17-25(30-4-2)27(29)26(28)24(23)16-22/h3,5,14-21H,4,6-13H2,1-2H3/b5-3+ |
| InChIKey | RQBZHKKYNWGJJM-HWKANZROSA-N |
| XLogP | 8.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|