C26H33FO — CID 139862049
1-fluoro-2-methoxy-6-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]naphthalene (PubChem CID 139862049) has the molecular formula C26H33FO and a molecular weight of 380.55 g/mol. Its IUPAC name is 1-fluoro-2-methoxy-6-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]naphthalene.
| Compound Name | 1-fluoro-2-methoxy-6-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]naphthalene |
|---|---|
| PubChem CID | 139862049 |
| Molecular Formula | C26H33FO |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 1-fluoro-2-methoxy-6-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]naphthalene |
| SMILES | C/C=C/C1CCC(C2CCC(c3ccc4c(F)c(OC)ccc4c3)CC2)CC1 |
| InChI | InChI=1S/C26H33FO/c1-3-4-18-5-7-19(8-6-18)20-9-11-21(12-10-20)22-13-15-24-23(17-22)14-16-25(28-2)26(24)27/h3-4,13-21H,5-12H2,1-2H3/b4-3+ |
| InChIKey | DXMJSNSNVHOEQR-ONEGZZNKSA-N |
| XLogP | 7.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|