C30H30F4O2 — CID 89124883
1-[4-[4-[4-[2-[2,3-difluoro-4-(oxiran-2-yl)phenyl]ethyl]phenyl]-2,3-difluorophenyl]cyclohexyl]ethanol (PubChem CID 89124883) has the molecular formula C30H30F4O2 and a molecular weight of 498.56 g/mol. Its IUPAC name is 1-[4-[4-[4-[2-[2,3-difluoro-4-(oxiran-2-yl)phenyl]ethyl]phenyl]-2,3-difluorophenyl]cyclohexyl]ethanol.
| Compound Name | 1-[4-[4-[4-[2-[2,3-difluoro-4-(oxiran-2-yl)phenyl]ethyl]phenyl]-2,3-difluorophenyl]cyclohexyl]ethanol |
|---|---|
| PubChem CID | 89124883 |
| Molecular Formula | C30H30F4O2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 1-[4-[4-[4-[2-[2,3-difluoro-4-(oxiran-2-yl)phenyl]ethyl]phenyl]-2,3-difluorophenyl]cyclohexyl]ethanol |
| SMILES | CC(O)C1CCC(c2ccc(-c3ccc(CCc4ccc(C5CO5)c(F)c4F)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C30H30F4O2/c1-17(35)19-8-10-21(11-9-19)24-15-14-23(28(32)29(24)33)20-5-2-18(3-6-20)4-7-22-12-13-25(26-16-36-26)30(34)27(22)31/h2-3,5-6,12-15,17,19,21,26,35H,4,7-11,16H2,1H3 |
| InChIKey | MWSZNLSABBKRAI-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|