C28H22O4 — CID 118605943
2-[4-[2,3-bis(oxiran-2-yl)-4-[2-[4-(oxiran-2-yl)phenyl]ethynyl]phenyl]phenyl]oxirane (PubChem CID 118605943) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[4-[2,3-bis(oxiran-2-yl)-4-[2-[4-(oxiran-2-yl)phenyl]ethynyl]phenyl]phenyl]oxirane.
| Compound Name | 2-[4-[2,3-bis(oxiran-2-yl)-4-[2-[4-(oxiran-2-yl)phenyl]ethynyl]phenyl]phenyl]oxirane |
|---|---|
| PubChem CID | 118605943 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-[4-[2,3-bis(oxiran-2-yl)-4-[2-[4-(oxiran-2-yl)phenyl]ethynyl]phenyl]phenyl]oxirane |
| SMILES | C(#Cc1ccc(-c2ccc(C3CO3)cc2)c(C2CO2)c1C1CO1)c1ccc(C2CO2)cc1 |
| InChI | InChI=1S/C28H22O4/c1-4-19(23-13-29-23)5-2-17(1)3-6-21-11-12-22(18-7-9-20(10-8-18)24-14-30-24)28(26-16-32-26)27(21)25-15-31-25/h1-2,4-5,7-12,23-26H,13-16H2 |
| InChIKey | OVKUUERTNJFPFU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 50.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|