C23H17F3O2 — CID 88977792
2-[4-[4-[(4-ethenyl-2,3-difluorophenoxy)methyl]phenyl]-2-fluorophenyl]oxirane (PubChem CID 88977792) has the molecular formula C23H17F3O2 and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-[4-[4-[(4-ethenyl-2,3-difluorophenoxy)methyl]phenyl]-2-fluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[(4-ethenyl-2,3-difluorophenoxy)methyl]phenyl]-2-fluorophenyl]oxirane |
|---|---|
| PubChem CID | 88977792 |
| Molecular Formula | C23H17F3O2 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[4-[4-[(4-ethenyl-2,3-difluorophenoxy)methyl]phenyl]-2-fluorophenyl]oxirane |
| SMILES | C=Cc1ccc(OCc2ccc(-c3ccc(C4CO4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C23H17F3O2/c1-2-15-8-10-20(23(26)22(15)25)27-12-14-3-5-16(6-4-14)17-7-9-18(19(24)11-17)21-13-28-21/h2-11,21H,1,12-13H2 |
| InChIKey | JAAAVDIKNUCNLW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|