C29H41F3 — CID 70797561
4-[4-[(E)-but-1-enyl]cyclohexyl]-1-[4-[4-(difluoromethyl)cyclohexyl]cyclohexyl]-2-fluorobenzene (PubChem CID 70797561) has the molecular formula C29H41F3 and a molecular weight of 446.64 g/mol. Its IUPAC name is 4-[4-[(E)-but-1-enyl]cyclohexyl]-1-[4-[4-(difluoromethyl)cyclohexyl]cyclohexyl]-2-fluorobenzene.
| Compound Name | 4-[4-[(E)-but-1-enyl]cyclohexyl]-1-[4-[4-(difluoromethyl)cyclohexyl]cyclohexyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 70797561 |
| Molecular Formula | C29H41F3 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 4-[4-[(E)-but-1-enyl]cyclohexyl]-1-[4-[4-(difluoromethyl)cyclohexyl]cyclohexyl]-2-fluorobenzene |
| SMILES | CC/C=C/C1CCC(c2ccc(C3CCC(C4CCC(C(F)F)CC4)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C29H41F3/c1-2-3-4-20-5-7-23(8-6-20)26-17-18-27(28(30)19-26)24-13-9-21(10-14-24)22-11-15-25(16-12-22)29(31)32/h3-4,17-25,29H,2,5-16H2,1H3/b4-3+ |
| InChIKey | GBVDBGTXOLISEY-ONEGZZNKSA-N |
| XLogP | 9.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|