C26H31F3O2 — CID 88997587
1-[2,3-difluoro-4-[2-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethyl]phenyl]butan-1-ol (PubChem CID 88997587) has the molecular formula C26H31F3O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-[2-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethyl]phenyl]butan-1-ol.
| Compound Name | 1-[2,3-difluoro-4-[2-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethyl]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 88997587 |
| Molecular Formula | C26H31F3O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[2,3-difluoro-4-[2-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethyl]phenyl]butan-1-ol |
| SMILES | CCCC(O)c1ccc(CCC2CCC(c3ccc(C4CO4)c(F)c3)CC2)c(F)c1F |
| InChI | InChI=1S/C26H31F3O2/c1-2-3-23(30)21-13-10-18(25(28)26(21)29)9-6-16-4-7-17(8-5-16)19-11-12-20(22(27)14-19)24-15-31-24/h10-14,16-17,23-24,30H,2-9,15H2,1H3 |
| InChIKey | JZEGEMCDXSBMKM-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|